C12H14N2O3 — CID 112599528
4-prop-2-ynyl-2,4-diazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 112599528) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-prop-2-ynyl-2,4-diazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | 4-prop-2-ynyl-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 112599528 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-prop-2-ynyl-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | C#CCN1C(=O)NC(=O)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C12H14N2O3/c1-2-8-14-10(16)12(6-4-3-5-7-12)9(15)13-11(14)17/h1H,3-8H2,(H,13,15,17) |
| InChIKey | AVVLOHCMGWITML-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|