C9H14N2O5S — CID 112599608
5,5-dimethyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 112599608) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is 5,5-dimethyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-dimethyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112599608 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5,5-dimethyl-1-(2-methylsulfonylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)C(=O)NC(=O)N(CCS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C9H14N2O5S/c1-9(2)6(12)10-8(14)11(7(9)13)4-5-17(3,15)16/h4-5H2,1-3H3,(H,10,12,14) |
| InChIKey | OALMHKZBIUQBGF-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|