C11H11N3O4 — CID 112599878
7-[(3-methyl-1,2-oxazol-5-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 112599878) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 7-[(3-methyl-1,2-oxazol-5-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-[(3-methyl-1,2-oxazol-5-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 112599878 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 7-[(3-methyl-1,2-oxazol-5-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | Cc1cc(CN2C(=O)NC(=O)C3(CC3)C2=O)on1 |
| InChI | InChI=1S/C11H11N3O4/c1-6-4-7(18-13-6)5-14-9(16)11(2-3-11)8(15)12-10(14)17/h4H,2-3,5H2,1H3,(H,12,15,17) |
| InChIKey | KYUIHTCRBIEFAQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|