About 2,3-dimethylpentane
2,3-dimethylpentane (PubChem CID 11260) has the molecular formula C7H16
and a molecular weight of 100.20 g/mol. Its IUPAC name is 2,3-dimethylpentane.
Molecular Properties
| Compound Name | 2,3-dimethylpentane |
| PubChem CID | 11260 |
| Molecular Formula | C7H16 |
| Molecular Weight | 100.20 g/mol |
| Exact Mass | 100.13 |
| IUPAC Name | 2,3-dimethylpentane |
| SMILES | CCC(C)C(C)C |
| InChI | InChI=1S/C7H16/c1-5-7(4)6(2)3/h6-7H,5H2,1-4H3 |
| InChIKey | WGECXQBGLLYSFP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylpentane?
The IUPAC name of 2,3-dimethylpentane (CID 11260) is 2,3-dimethylpentane.
What is the SMILES notation for 2,3-dimethylpentane?
The canonical SMILES for 2,3-dimethylpentane is CCC(C)C(C)C.
What is the InChIKey of 2,3-dimethylpentane?
The InChIKey is WGECXQBGLLYSFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16/c1-5-7(4)6(2)3/h6-7H,5H2,1-4H3.
What are the key properties of 2,3-dimethylpentane?
2,3-dimethylpentane has a molecular weight of 100.20 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylpentane is sourced from PubChem (CID 11260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).