C27H27F5N2 — CID 11260029
2-(2,3,4,5,6-pentafluorophenyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 11260029) has the molecular formula C27H27F5N2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 11260029 |
| Molecular Formula | C27H27F5N2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2c2c(F)c(F)c(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C27H27F5N2/c1-13-9-15(3)25(16(4)10-13)33-7-8-34(26-17(5)11-14(2)12-18(26)6)27(33)19-20(28)22(30)24(32)23(31)21(19)29/h9-12,27H,7-8H2,1-6H3 |
| InChIKey | HSIQYZZZKQLXLK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|