C21H16F4N6O3 — CID 11260071
1-ethyl-3-[4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea (PubChem CID 11260071) has the molecular formula C21H16F4N6O3 and a molecular weight of 476.39 g/mol. Its IUPAC name is 1-ethyl-3-[4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 11260071 |
| Molecular Formula | C21H16F4N6O3 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-ethyl-3-[4-pyrazol-1-yl-6-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2c(-n3cccn3)cc(-c3ccc4c(c3)OC(F)(F)C(F)(F)O4)cc2[nH]1 |
| InChI | InChI=1S/C21H16F4N6O3/c1-2-26-19(32)30-18-28-13-8-12(9-14(17(13)29-18)31-7-3-6-27-31)11-4-5-15-16(10-11)34-21(24,25)20(22,23)33-15/h3-10H,2H2,1H3,(H3,26,28,29,30,32) |
| InChIKey | XRYHLWMHDBRFRB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|