C11H18N2O5S — CID 112600923
1-(1-methylsulfonylpropan-2-yl)-5-propyl-1,3-diazinane-2,4,6-trione (PubChem CID 112600923) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-(1-methylsulfonylpropan-2-yl)-5-propyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1-methylsulfonylpropan-2-yl)-5-propyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 112600923 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-(1-methylsulfonylpropan-2-yl)-5-propyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC1C(=O)NC(=O)N(C(C)CS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C11H18N2O5S/c1-4-5-8-9(14)12-11(16)13(10(8)15)7(2)6-19(3,17)18/h7-8H,4-6H2,1-3H3,(H,12,14,16) |
| InChIKey | BOAHGKMYHHGWDI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|