C13H13N3O3 — CID 112601247
7-(2,6-dimethyl-3-pyridinyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 112601247) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 7-(2,6-dimethyl-3-pyridinyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-(2,6-dimethyl-3-pyridinyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 112601247 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 7-(2,6-dimethyl-3-pyridinyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)C3(CC3)C2=O)c(C)n1 |
| InChI | InChI=1S/C13H13N3O3/c1-7-3-4-9(8(2)14-7)16-11(18)13(5-6-13)10(17)15-12(16)19/h3-4H,5-6H2,1-2H3,(H,15,17,19) |
| InChIKey | CNXUXTLQNBFHFS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|