C17H11F10N3O2 — CID 11260128
4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]-1-methyl-6-oxopyridine-3-carboxamide (PubChem CID 11260128) has the molecular formula C17H11F10N3O2 and a molecular weight of 479.27 g/mol. Its IUPAC name is 4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]-1-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | 4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]-1-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 11260128 |
| Molecular Formula | C17H11F10N3O2 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 4-[2-fluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)anilino]-1-methyl-6-oxopyridine-3-carboxamide |
| SMILES | Cn1cc(C(N)=O)c(Nc2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2F)cc1=O |
| InChI | InChI=1S/C17H11F10N3O2/c1-30-6-8(13(28)32)11(5-12(30)31)29-10-3-2-7(4-9(10)18)14(19,20)15(21,22)16(23,24)17(25,26)27/h2-6,29H,1H3,(H2,28,32) |
| InChIKey | KNSPCEZMVKXOOC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|