C26H28N2O7 — CID 11260161
20-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione (PubChem CID 11260161) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is 20-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione.
| Compound Name | 20-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
|---|---|
| PubChem CID | 11260161 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 20-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propyl]-15,16-dimethoxy-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
| SMILES | COc1cc2c3c(n(CCCNC(C)(C)CO)c(=O)c2cc1OC)-c1cc2c(cc1C3=O)OCO2 |
| InChI | InChI=1S/C26H28N2O7/c1-26(2,12-29)27-6-5-7-28-23-15-9-20-21(35-13-34-20)10-16(15)24(30)22(23)14-8-18(32-3)19(33-4)11-17(14)25(28)31/h8-11,27,29H,5-7,12-13H2,1-4H3 |
| InChIKey | TVSRIYGCEMFJQR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|