C14H20FNO3 — CID 112604524
N-(2-ethoxy-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 112604524) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is N-(2-ethoxy-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-(2-ethoxy-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 112604524 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(2-ethoxy-4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | CCOc1cc(F)ccc1NC(=O)COC(C)(C)C |
| InChI | InChI=1S/C14H20FNO3/c1-5-18-12-8-10(15)6-7-11(12)16-13(17)9-19-14(2,3)4/h6-8H,5,9H2,1-4H3,(H,16,17) |
| InChIKey | DEUFQZDISILXRD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |