C14H12FN3O — CID 112606607
2-fluoro-6-[(1H-indazol-4-ylamino)methyl]phenol (PubChem CID 112606607) has the molecular formula C14H12FN3O and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-fluoro-6-[(1H-indazol-4-ylamino)methyl]phenol.
| Compound Name | 2-fluoro-6-[(1H-indazol-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 112606607 |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-fluoro-6-[(1H-indazol-4-ylamino)methyl]phenol |
| SMILES | Oc1c(F)cccc1CNc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C14H12FN3O/c15-11-4-1-3-9(14(11)19)7-16-12-5-2-6-13-10(12)8-17-18-13/h1-6,8,16,19H,7H2,(H,17,18) |
| InChIKey | MNVRIQLPKQMOHD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|