C11H12ClNO3S — CID 112606991
2-chloro-6-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]phenol (PubChem CID 112606991) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-chloro-6-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]phenol.
| Compound Name | 2-chloro-6-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 112606991 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-chloro-6-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]phenol |
| SMILES | O=S1(=O)C=CC(NCc2cccc(Cl)c2O)C1 |
| InChI | InChI=1S/C11H12ClNO3S/c12-10-3-1-2-8(11(10)14)6-13-9-4-5-17(15,16)7-9/h1-5,9,13-14H,6-7H2 |
| InChIKey | GOJCEJOIPBHDDR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|