C28H37NO6Si — CID 11260771
5-[4-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 11260771) has the molecular formula C28H37NO6Si and a molecular weight of 511.69 g/mol. Its IUPAC name is 5-[4-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-[4-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 11260771 |
| Molecular Formula | C28H37NO6Si |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 5-[4-[2,2-dimethylpropyl(dimethyl)silyl]-2-methylphenoxy]-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Oc3ccc([Si](C)(C)CC(C)(C)C)cc3C)o2)c(OC)c1 |
| InChI | InChI=1S/C28H37NO6Si/c1-18-14-20(36(8,9)17-28(2,3)4)10-11-21(18)34-25-13-12-22(35-25)27(30)29-26-23(32-6)15-19(31-5)16-24(26)33-7/h10-16H,17H2,1-9H3,(H,29,30) |
| InChIKey | IGDXDASHFJSCDK-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|