C30H52O3Si2 — CID 11260869
(3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 11260869) has the molecular formula C30H52O3Si2 and a molecular weight of 516.92 g/mol. Its IUPAC name is (3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 11260869 |
| Molecular Formula | C30H52O3Si2 |
| Molecular Weight | 516.92 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | (3aS,4S,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnona-1,6-diynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CCC#CC[C@H](C)[C@@H](C#C[C@@H]1[C@H]2CC(=O)C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H52O3Si2/c1-13-14-15-16-22(2)27(32-34(9,10)29(3,4)5)18-17-25-26-21-24(31)19-23(26)20-28(25)33-35(11,12)30(6,7)8/h22-23,25-28H,13,16,19-21H2,1-12H3/t22-,23-,25+,26-,27+,28+/m0/s1 |
| InChIKey | YPMKMTLGONRJFB-DNMRJFKRSA-N |
| XLogP | 7.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.92 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|