C19H20BrF5N6O — CID 11260966
5-bromo-6-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11260966) has the molecular formula C19H20BrF5N6O and a molecular weight of 523.30 g/mol. Its IUPAC name is 5-bromo-6-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-bromo-6-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11260966 |
| Molecular Formula | C19H20BrF5N6O |
| Molecular Weight | 523.30 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | 5-bromo-6-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCN(C)C)cc2F)c(Br)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C19H20BrF5N6O/c1-10(19(23,24)25)28-17-15(16(20)29-18-26-9-27-31(17)18)14-12(21)7-11(8-13(14)22)32-6-4-5-30(2)3/h7-10,28H,4-6H2,1-3H3/t10-/m0/s1 |
| InChIKey | VFFSFDFJZAYCBT-JTQLQIEISA-N |
| XLogP | 4.53 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|