C31H20F3NO4 — CID 11261037
4-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoic acid (PubChem CID 11261037) has the molecular formula C31H20F3NO4 and a molecular weight of 527.50 g/mol. Its IUPAC name is 4-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 11261037 |
| Molecular Formula | C31H20F3NO4 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 4-[[3-[3-benzoyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2cccc(-c3c(C(=O)c4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C31H20F3NO4/c32-31(33,34)26-11-5-10-24-27(25(17-35-28(24)26)29(36)20-6-2-1-3-7-20)22-8-4-9-23(16-22)39-18-19-12-14-21(15-13-19)30(37)38/h1-17H,18H2,(H,37,38) |
| InChIKey | NDCQPJCNZBQYAO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |