About 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline
4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 1126118) has the molecular formula C9H5ClN4
and a molecular weight of 204.62 g/mol. Its IUPAC name is 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline.
Molecular Properties
| Compound Name | 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline |
| PubChem CID | 1126118 |
| Molecular Formula | C9H5ClN4 |
| Molecular Weight | 204.62 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | Clc1nc2ccccc2n2cnnc12 |
| InChI | InChI=1S/C9H5ClN4/c10-8-9-13-11-5-14(9)7-4-2-1-3-6(7)12-8/h1-5H |
| InChIKey | NLAAGSHTVZHFTR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline?
The IUPAC name of 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline (CID 1126118) is 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline.
What is the SMILES notation for 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline?
The canonical SMILES for 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline is Clc1nc2ccccc2n2cnnc12.
What is the InChIKey of 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline?
The InChIKey is NLAAGSHTVZHFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN4/c10-8-9-13-11-5-14(9)7-4-2-1-3-6(7)12-8/h1-5H.
What are the key properties of 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline?
4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline has a molecular weight of 204.62 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-[1,2,4]triazolo[4,3-a]quinoxaline is sourced from PubChem (CID 1126118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).