C12H11FN2O3 — CID 112611835
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3-fluorobenzaldehyde (PubChem CID 112611835) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3-fluorobenzaldehyde.
| Compound Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 112611835 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methoxy]-3-fluorobenzaldehyde |
| SMILES | CCc1nnc(COc2c(F)cccc2C=O)o1 |
| InChI | InChI=1S/C12H11FN2O3/c1-2-10-14-15-11(18-10)7-17-12-8(6-16)4-3-5-9(12)13/h3-6H,2,7H2,1H3 |
| InChIKey | PONDNVPQFLOCPR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|