C14H11Cl2FO2 — CID 112612937
[2-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]methanol (PubChem CID 112612937) has the molecular formula C14H11Cl2FO2 and a molecular weight of 301.14 g/mol. Its IUPAC name is [2-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]methanol.
| Compound Name | [2-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 112612937 |
| Molecular Formula | C14H11Cl2FO2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | [2-[(2,5-dichlorophenyl)methoxy]-3-fluorophenyl]methanol |
| SMILES | OCc1cccc(F)c1OCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H11Cl2FO2/c15-11-4-5-12(16)10(6-11)8-19-14-9(7-18)2-1-3-13(14)17/h1-6,18H,7-8H2 |
| InChIKey | OAARBUXEYRPMBV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |