C29H30ClN5O4 — CID 11261324
(3R)-N-[(2R)-3-(4-chlorophenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 11261324) has the molecular formula C29H30ClN5O4 and a molecular weight of 548.04 g/mol. Its IUPAC name is (3R)-N-[(2R)-3-(4-chlorophenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3R)-N-[(2R)-3-(4-chlorophenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11261324 |
| Molecular Formula | C29H30ClN5O4 |
| Molecular Weight | 548.04 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | (3R)-N-[(2R)-3-(4-chlorophenyl)-1-[4-(2-nitrophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | O=C(N[C@H](Cc1ccc(Cl)cc1)C(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1)[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C29H30ClN5O4/c30-23-11-9-20(10-12-23)17-25(32-28(36)24-18-21-5-1-2-6-22(21)19-31-24)29(37)34-15-13-33(14-16-34)26-7-3-4-8-27(26)35(38)39/h1-12,24-25,31H,13-19H2,(H,32,36)/t24-,25-/m1/s1 |
| InChIKey | QOUBFLWPVOUBIQ-JWQCQUIFSA-N |
| XLogP | 3.34 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.04 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|