C13H15ClFN3O — CID 112613661
5-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-1-propan-2-yl-1,2,4-triazole (PubChem CID 112613661) has the molecular formula C13H15ClFN3O and a molecular weight of 283.73 g/mol. Its IUPAC name is 5-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-1-propan-2-yl-1,2,4-triazole.
| Compound Name | 5-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-1-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 112613661 |
| Molecular Formula | C13H15ClFN3O |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 5-[[2-(chloromethyl)-6-fluorophenoxy]methyl]-1-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1ncnc1COc1c(F)cccc1CCl |
| InChI | InChI=1S/C13H15ClFN3O/c1-9(2)18-12(16-8-17-18)7-19-13-10(6-14)4-3-5-11(13)15/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | DGJDEBBUUXSKBI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|