C15H13BrCl2O — CID 112614167
1-(bromomethyl)-2-[(2,6-dichlorophenyl)methoxy]-3-methylbenzene (PubChem CID 112614167) has the molecular formula C15H13BrCl2O and a molecular weight of 360.08 g/mol. Its IUPAC name is 1-(bromomethyl)-2-[(2,6-dichlorophenyl)methoxy]-3-methylbenzene.
| Compound Name | 1-(bromomethyl)-2-[(2,6-dichlorophenyl)methoxy]-3-methylbenzene |
|---|---|
| PubChem CID | 112614167 |
| Molecular Formula | C15H13BrCl2O |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 1-(bromomethyl)-2-[(2,6-dichlorophenyl)methoxy]-3-methylbenzene |
| SMILES | Cc1cccc(CBr)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H13BrCl2O/c1-10-4-2-5-11(8-16)15(10)19-9-12-13(17)6-3-7-14(12)18/h2-7H,8-9H2,1H3 |
| InChIKey | GGIQNLGKVIAIEE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|