C14H15BrOS — CID 112614183
3-[2-[2-(bromomethyl)-6-methylphenoxy]ethyl]thiophene (PubChem CID 112614183) has the molecular formula C14H15BrOS and a molecular weight of 311.24 g/mol. Its IUPAC name is 3-[2-[2-(bromomethyl)-6-methylphenoxy]ethyl]thiophene.
| Compound Name | 3-[2-[2-(bromomethyl)-6-methylphenoxy]ethyl]thiophene |
|---|---|
| PubChem CID | 112614183 |
| Molecular Formula | C14H15BrOS |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 3-[2-[2-(bromomethyl)-6-methylphenoxy]ethyl]thiophene |
| SMILES | Cc1cccc(CBr)c1OCCc1ccsc1 |
| InChI | InChI=1S/C14H15BrOS/c1-11-3-2-4-13(9-15)14(11)16-7-5-12-6-8-17-10-12/h2-4,6,8,10H,5,7,9H2,1H3 |
| InChIKey | OOXITJQDFOKAQT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|