C12H13FO4 — CID 112614242
(E)-3-[3-fluoro-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid (PubChem CID 112614242) has the molecular formula C12H13FO4 and a molecular weight of 240.23 g/mol. Its IUPAC name is (E)-3-[3-fluoro-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 112614242 |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (E)-3-[3-fluoro-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid |
| SMILES | COCCOc1c(F)cccc1/C=C/C(=O)O |
| InChI | InChI=1S/C12H13FO4/c1-16-7-8-17-12-9(5-6-11(14)15)3-2-4-10(12)13/h2-6H,7-8H2,1H3,(H,14,15)/b6-5+ |
| InChIKey | RWWGBFJNGVKMJL-AATRIKPKSA-N |
| XLogP | 1.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|