C31H60O6Si — CID 11261453
1-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3R)-2,3-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-4-(methoxymethoxymethyl)cyclohex-3-en-1-yl]ethanol (PubChem CID 11261453) has the molecular formula C31H60O6Si and a molecular weight of 556.90 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3R)-2,3-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-4-(methoxymethoxymethyl)cyclohex-3-en-1-yl]ethanol.
| Compound Name | 1-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3R)-2,3-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-4-(methoxymethoxymethyl)cyclohex-3-en-1-yl]ethanol |
|---|---|
| PubChem CID | 11261453 |
| Molecular Formula | C31H60O6Si |
| Molecular Weight | 556.90 g/mol |
| Exact Mass | 556.42 |
| IUPAC Name | 1-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3R)-2,3-dimethyl-4-tri(propan-2-yl)silyloxybutyl]-4-(methoxymethoxymethyl)cyclohex-3-en-1-yl]ethanol |
| SMILES | COCOCC1=C[C@H]([C@H]2COC(C)(C)O2)[C@@](C[C@H](C)[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)(C(C)O)CC1 |
| InChI | InChI=1S/C31H60O6Si/c1-21(2)38(22(3)4,23(5)6)36-17-25(8)24(7)16-31(26(9)32)14-13-27(18-34-20-33-12)15-28(31)29-19-35-30(10,11)37-29/h15,21-26,28-29,32H,13-14,16-20H2,1-12H3/t24-,25-,26?,28+,29+,31-/m0/s1 |
| InChIKey | VKJBGICCRCKUBO-WXJUAPTKSA-N |
| XLogP | 7.32 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|