C14H18N2O2 — CID 112615436
1-[3-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]propan-2-amine (PubChem CID 112615436) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-[3-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]propan-2-amine.
| Compound Name | 1-[3-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 112615436 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-[3-methyl-2-(1,2-oxazol-5-ylmethoxy)phenyl]propan-2-amine |
| SMILES | Cc1cccc(CC(C)N)c1OCc1ccno1 |
| InChI | InChI=1S/C14H18N2O2/c1-10-4-3-5-12(8-11(2)15)14(10)17-9-13-6-7-16-18-13/h3-7,11H,8-9,15H2,1-2H3 |
| InChIKey | QOYPFIRUAHXXAM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |