C15H23NO — CID 112615496
1-(2-but-3-enoxy-3-methylphenyl)butan-2-amine (PubChem CID 112615496) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-(2-but-3-enoxy-3-methylphenyl)butan-2-amine.
| Compound Name | 1-(2-but-3-enoxy-3-methylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 112615496 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-(2-but-3-enoxy-3-methylphenyl)butan-2-amine |
| SMILES | C=CCCOc1c(C)cccc1CC(N)CC |
| InChI | InChI=1S/C15H23NO/c1-4-6-10-17-15-12(3)8-7-9-13(15)11-14(16)5-2/h4,7-9,14H,1,5-6,10-11,16H2,2-3H3 |
| InChIKey | VPXWDFJIRSHQLP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|