C13H20FNO2 — CID 112615799
1-[3-fluoro-2-(3-methoxypropoxy)phenyl]propan-2-amine (PubChem CID 112615799) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 1-[3-fluoro-2-(3-methoxypropoxy)phenyl]propan-2-amine.
| Compound Name | 1-[3-fluoro-2-(3-methoxypropoxy)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 112615799 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-[3-fluoro-2-(3-methoxypropoxy)phenyl]propan-2-amine |
| SMILES | COCCCOc1c(F)cccc1CC(C)N |
| InChI | InChI=1S/C13H20FNO2/c1-10(15)9-11-5-3-6-12(14)13(11)17-8-4-7-16-2/h3,5-6,10H,4,7-9,15H2,1-2H3 |
| InChIKey | YGLHSYDJQBRPRL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|