C14H18FNO — CID 112615990
1-(2-but-3-ynoxy-3-fluorophenyl)butan-2-amine (PubChem CID 112615990) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 1-(2-but-3-ynoxy-3-fluorophenyl)butan-2-amine.
| Compound Name | 1-(2-but-3-ynoxy-3-fluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 112615990 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-(2-but-3-ynoxy-3-fluorophenyl)butan-2-amine |
| SMILES | C#CCCOc1c(F)cccc1CC(N)CC |
| InChI | InChI=1S/C14H18FNO/c1-3-5-9-17-14-11(10-12(16)4-2)7-6-8-13(14)15/h1,6-8,12H,4-5,9-10,16H2,2H3 |
| InChIKey | RRBCOQQLKWFEMH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|