C9H16N2O4 — CID 112617409
methyl 2-[(4-methylmorpholin-2-yl)methylamino]-2-oxoacetate (PubChem CID 112617409) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl 2-[(4-methylmorpholin-2-yl)methylamino]-2-oxoacetate.
| Compound Name | methyl 2-[(4-methylmorpholin-2-yl)methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 112617409 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | methyl 2-[(4-methylmorpholin-2-yl)methylamino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCC1CN(C)CCO1 |
| InChI | InChI=1S/C9H16N2O4/c1-11-3-4-15-7(6-11)5-10-8(12)9(13)14-2/h7H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | LNKKCCHUDGJNGO-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|