C10H11N3O2 — CID 112617609
methyl 1-ethylimidazo[4,5-c]pyridine-2-carboxylate (PubChem CID 112617609) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is methyl 1-ethylimidazo[4,5-c]pyridine-2-carboxylate.
| Compound Name | methyl 1-ethylimidazo[4,5-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 112617609 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | methyl 1-ethylimidazo[4,5-c]pyridine-2-carboxylate |
| SMILES | CCn1c(C(=O)OC)nc2cnccc21 |
| InChI | InChI=1S/C10H11N3O2/c1-3-13-8-4-5-11-6-7(8)12-9(13)10(14)15-2/h4-6H,3H2,1-2H3 |
| InChIKey | ZXUMLLWZTHYQKL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |