C27H17Cl2F3N6O2 — CID 11261764
7,8-bis(4-chlorophenyl)-4-methyl-11-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9-triene-3,12-dione (PubChem CID 11261764) has the molecular formula C27H17Cl2F3N6O2 and a molecular weight of 585.37 g/mol. Its IUPAC name is 7,8-bis(4-chlorophenyl)-4-methyl-11-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9-triene-3,12-dione.
| Compound Name | 7,8-bis(4-chlorophenyl)-4-methyl-11-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9-triene-3,12-dione |
|---|---|
| PubChem CID | 11261764 |
| Molecular Formula | C27H17Cl2F3N6O2 |
| Molecular Weight | 585.37 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 7,8-bis(4-chlorophenyl)-4-methyl-11-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4,5,10,11-hexazatricyclo[7.3.0.02,6]dodeca-5,7,9-triene-3,12-dione |
| SMILES | Cn1nc2c(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c3nn(Cc4ccc(C(F)(F)F)cc4)c(=O)n3n2c1=O |
| InChI | InChI=1S/C27H17Cl2F3N6O2/c1-35-25(39)37-23(33-35)21(16-4-10-19(28)11-5-16)22(17-6-12-20(29)13-7-17)24-34-36(26(40)38(24)37)14-15-2-8-18(9-3-15)27(30,31)32/h2-13H,14H2,1H3 |
| InChIKey | KGXIHUSLNSDPDY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |