C31H27ClN4O4S — CID 11261792
N-[4-[3-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-9,12-dimethyl-10-oxo-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 11261792) has the molecular formula C31H27ClN4O4S and a molecular weight of 587.10 g/mol. Its IUPAC name is N-[4-[3-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-9,12-dimethyl-10-oxo-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | N-[4-[3-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-9,12-dimethyl-10-oxo-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 11261792 |
| Molecular Formula | C31H27ClN4O4S |
| Molecular Weight | 587.10 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | N-[4-[3-[(3-chloro-4-methoxyphenyl)carbamoyl]phenyl]-1,3-thiazol-2-yl]-9,12-dimethyl-10-oxo-9-azatricyclo[6.2.2.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccc(-c3csc(NC(=O)C4(C)CC5C(=O)N(C)C4c4ccccc45)n3)c2)cc1Cl |
| InChI | InChI=1S/C31H27ClN4O4S/c1-31(15-22-20-9-4-5-10-21(20)26(31)36(2)28(22)38)29(39)35-30-34-24(16-41-30)17-7-6-8-18(13-17)27(37)33-19-11-12-25(40-3)23(32)14-19/h4-14,16,22,26H,15H2,1-3H3,(H,33,37)(H,34,35,39) |
| InChIKey | IWKMCQRQWGKOTF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.10 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |