C30H34ClF3N4O3 — CID 11261838
N-[3-[4-[(6-chloro-2-pyridinyl)oxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butyl]-2,4-dimethyl-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 11261838) has the molecular formula C30H34ClF3N4O3 and a molecular weight of 591.07 g/mol. Its IUPAC name is N-[3-[4-[(6-chloro-2-pyridinyl)oxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butyl]-2,4-dimethyl-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[3-[4-[(6-chloro-2-pyridinyl)oxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butyl]-2,4-dimethyl-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 11261838 |
| Molecular Formula | C30H34ClF3N4O3 |
| Molecular Weight | 591.07 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | N-[3-[4-[(6-chloro-2-pyridinyl)oxy-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-yl]butyl]-2,4-dimethyl-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | Cc1cc[n+]([O-])c(C)c1C(=O)NCCC(C)N1CCC(C(Oc2cccc(Cl)n2)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C30H34ClF3N4O3/c1-19-12-18-38(40)21(3)27(19)29(39)35-15-11-20(2)37-16-13-23(14-17-37)28(41-26-6-4-5-25(31)36-26)22-7-9-24(10-8-22)30(32,33)34/h4-10,12,18,20,23,28H,11,13-17H2,1-3H3,(H,35,39) |
| InChIKey | XWJJXKOXOVOWDD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.07 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|