C30H26Cl2N4O3S — CID 11261858
(4-chlorophenyl) 6-chloro-1-[4-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 11261858) has the molecular formula C30H26Cl2N4O3S and a molecular weight of 593.54 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[4-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[4-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 11261858 |
| Molecular Formula | C30H26Cl2N4O3S |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[4-[2-[(5-methyl-1,3-thiazol-2-yl)amino]ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1cnc(NCCOc2ccc(C3c4[nH]c5ccc(Cl)cc5c4CCN3C(=O)Oc3ccc(Cl)cc3)cc2)s1 |
| InChI | InChI=1S/C30H26Cl2N4O3S/c1-18-17-34-29(40-18)33-13-15-38-22-7-2-19(3-8-22)28-27-24(25-16-21(32)6-11-26(25)35-27)12-14-36(28)30(37)39-23-9-4-20(31)5-10-23/h2-11,16-17,28,35H,12-15H2,1H3,(H,33,34) |
| InChIKey | CJLKDYPSWBNEOU-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|