About methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate
methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 112619091) has the molecular formula C5H4F2N2O3
and a molecular weight of 178.09 g/mol. Its IUPAC name is methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate |
| PubChem CID | 112619091 |
| Molecular Formula | C5H4F2N2O3 |
| Molecular Weight | 178.09 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate |
| SMILES | COC(=O)c1nnc(C(F)F)o1 |
| InChI | InChI=1S/C5H4F2N2O3/c1-11-5(10)4-9-8-3(12-4)2(6)7/h2H,1H3 |
| InChIKey | JOJSJIHCORQSND-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.09 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate (CID 112619091) is methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate is COC(=O)c1nnc(C(F)F)o1.
What is the InChIKey of methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is JOJSJIHCORQSND-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F2N2O3/c1-11-5(10)4-9-8-3(12-4)2(6)7/h2H,1H3.
What are the key properties of methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate?
methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 178.09 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(difluoromethyl)-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 112619091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).