C11H10N2O4 — CID 112619546
5-(2-phenoxyethyl)-1,3,4-oxadiazole-2-carboxylic acid (PubChem CID 112619546) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 5-(2-phenoxyethyl)-1,3,4-oxadiazole-2-carboxylic acid.
| Compound Name | 5-(2-phenoxyethyl)-1,3,4-oxadiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 112619546 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 5-(2-phenoxyethyl)-1,3,4-oxadiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nnc(CCOc2ccccc2)o1 |
| InChI | InChI=1S/C11H10N2O4/c14-11(15)10-13-12-9(17-10)6-7-16-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,15) |
| InChIKey | AWIKAQQJLOWNRF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |