C41H43NO5 — CID 11262140
(1R,2S,3S,4R,5S)-2-(benzylamino)-3,4,5-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentan-1-ol (PubChem CID 11262140) has the molecular formula C41H43NO5 and a molecular weight of 629.80 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-2-(benzylamino)-3,4,5-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,2S,3S,4R,5S)-2-(benzylamino)-3,4,5-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 11262140 |
| Molecular Formula | C41H43NO5 |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | (1R,2S,3S,4R,5S)-2-(benzylamino)-3,4,5-tris(phenylmethoxy)-1-(phenylmethoxymethyl)cyclopentan-1-ol |
| SMILES | O[C@@]1(COCc2ccccc2)[C@@H](NCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H43NO5/c43-41(31-44-27-33-18-8-2-9-19-33)39(42-26-32-16-6-1-7-17-32)37(45-28-34-20-10-3-11-21-34)38(46-29-35-22-12-4-13-23-35)40(41)47-30-36-24-14-5-15-25-36/h1-25,37-40,42-43H,26-31H2/t37-,38-,39+,40+,41+/m1/s1 |
| InChIKey | QOHCWMHUFDDLEO-HJRBIJKLSA-N |
| XLogP | 6.86 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |