C10H12BrF2NO — CID 112621644
2-[5-bromo-2-(difluoromethoxy)-3-methylphenyl]ethanamine (PubChem CID 112621644) has the molecular formula C10H12BrF2NO and a molecular weight of 280.11 g/mol. Its IUPAC name is 2-[5-bromo-2-(difluoromethoxy)-3-methylphenyl]ethanamine.
| Compound Name | 2-[5-bromo-2-(difluoromethoxy)-3-methylphenyl]ethanamine |
|---|---|
| PubChem CID | 112621644 |
| Molecular Formula | C10H12BrF2NO |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-[5-bromo-2-(difluoromethoxy)-3-methylphenyl]ethanamine |
| SMILES | Cc1cc(Br)cc(CCN)c1OC(F)F |
| InChI | InChI=1S/C10H12BrF2NO/c1-6-4-8(11)5-7(2-3-14)9(6)15-10(12)13/h4-5,10H,2-3,14H2,1H3 |
| InChIKey | OTFVODBLEMVEKL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |