C14H19BrN2O — CID 112621679
2-[2-(2-aminopropyl)-4-bromo-6-methylphenoxy]butanenitrile (PubChem CID 112621679) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-[2-(2-aminopropyl)-4-bromo-6-methylphenoxy]butanenitrile.
| Compound Name | 2-[2-(2-aminopropyl)-4-bromo-6-methylphenoxy]butanenitrile |
|---|---|
| PubChem CID | 112621679 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[2-(2-aminopropyl)-4-bromo-6-methylphenoxy]butanenitrile |
| SMILES | CCC(C#N)Oc1c(C)cc(Br)cc1CC(C)N |
| InChI | InChI=1S/C14H19BrN2O/c1-4-13(8-16)18-14-9(2)5-12(15)7-11(14)6-10(3)17/h5,7,10,13H,4,6,17H2,1-3H3 |
| InChIKey | SBPNSMSBNXVCTL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |