C15H29N3O — CID 112622061
[1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-methoxypiperidin-2-yl]methanamine (PubChem CID 112622061) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is [1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-methoxypiperidin-2-yl]methanamine.
| Compound Name | [1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-methoxypiperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 112622061 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | [1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-4-methoxypiperidin-2-yl]methanamine |
| SMILES | COC1CCN(C2CCN3CCCCC23)C(CN)C1 |
| InChI | InChI=1S/C15H29N3O/c1-19-13-5-9-18(12(10-13)11-16)15-6-8-17-7-3-2-4-14(15)17/h12-15H,2-11,16H2,1H3 |
| InChIKey | HROLHHCYIGKDKM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |