C39H40ClF3N2O — CID 11262241
5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-diethylnaphthalen-1-amine (PubChem CID 11262241) has the molecular formula C39H40ClF3N2O and a molecular weight of 645.21 g/mol. Its IUPAC name is 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-diethylnaphthalen-1-amine.
| Compound Name | 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-diethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 11262241 |
| Molecular Formula | C39H40ClF3N2O |
| Molecular Weight | 645.21 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 5-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N,N-diethylnaphthalen-1-amine |
| SMILES | CCN(CC)c1cccc2c(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)cccc12 |
| InChI | InChI=1S/C39H40ClF3N2O/c1-3-45(4-2)36-23-12-21-33-32(36)20-13-24-37(33)46-26-14-25-44(27-31-19-11-22-35(38(31)40)39(41,42)43)28-34(29-15-7-5-8-16-29)30-17-9-6-10-18-30/h5-13,15-24,34H,3-4,14,25-28H2,1-2H3 |
| InChIKey | AKZOWLYHGGTUQD-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.21 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|