C12H23F3N2O2 — CID 112622698
[4-methoxy-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-2-yl]methanamine (PubChem CID 112622698) has the molecular formula C12H23F3N2O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is [4-methoxy-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-2-yl]methanamine.
| Compound Name | [4-methoxy-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-2-yl]methanamine |
|---|---|
| PubChem CID | 112622698 |
| Molecular Formula | C12H23F3N2O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | [4-methoxy-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidin-2-yl]methanamine |
| SMILES | COC1CCN(CCCOCC(F)(F)F)C(CN)C1 |
| InChI | InChI=1S/C12H23F3N2O2/c1-18-11-3-5-17(10(7-11)8-16)4-2-6-19-9-12(13,14)15/h10-11H,2-9,16H2,1H3 |
| InChIKey | CBFYNTMFMXGEEC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|