C39H41O5PS — CID 11262291
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)pentanoate (PubChem CID 11262291) has the molecular formula C39H41O5PS and a molecular weight of 652.79 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)pentanoate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)pentanoate |
|---|---|
| PubChem CID | 11262291 |
| Molecular Formula | C39H41O5PS |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 3-oxo-2-(triphenyl-λ5-phosphanylidene)pentanoate |
| SMILES | CCC(=O)C(C(=O)O[C@H]1C[C@@H]2CC[C@@]1(CS(=O)(=O)c1ccccc1)C2(C)C)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H41O5PS/c1-4-34(40)36(45(30-17-9-5-10-18-30,31-19-11-6-12-20-31)32-21-13-7-14-22-32)37(41)44-35-27-29-25-26-39(35,38(29,2)3)28-46(42,43)33-23-15-8-16-24-33/h5-24,29,35H,4,25-28H2,1-3H3/t29-,35-,39-/m0/s1 |
| InChIKey | QDQKJOOPHVCGLX-BZDMZOLCSA-N |
| XLogP | 6.34 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|