About 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene
4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene (PubChem CID 112623615) has the molecular formula C8H8BrNS
and a molecular weight of 230.13 g/mol. Its IUPAC name is 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene.
Molecular Properties
| Compound Name | 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene |
| PubChem CID | 112623615 |
| Molecular Formula | C8H8BrNS |
| Molecular Weight | 230.13 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene |
| SMILES | Brc1nc2c(s1)C1CCC2C1 |
| InChI | InChI=1S/C8H8BrNS/c9-8-10-6-4-1-2-5(3-4)7(6)11-8/h4-5H,1-3H2 |
| InChIKey | UIZXFEGPYVODLL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
The IUPAC name of 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene (CID 112623615) is 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene.
What is the SMILES notation for 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
The canonical SMILES for 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene is Brc1nc2c(s1)C1CCC2C1.
What is the InChIKey of 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
The InChIKey is UIZXFEGPYVODLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNS/c9-8-10-6-4-1-2-5(3-4)7(6)11-8/h4-5H,1-3H2.
What are the key properties of 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene?
4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene has a molecular weight of 230.13 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-thia-5-azatricyclo[5.2.1.02,6]deca-2(6),4-diene is sourced from PubChem (CID 112623615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).