C27H32N5O4S3+ — CID 11262485
2,6-Dibutyl-4-phenyl-1-{4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl}-1$l^{5}-pyridin-1-ylium perchlorate (PubChem CID 11262485) has the molecular formula C27H32N5O4S3+ and a molecular weight of 586.80 g/mol. Its IUPAC name is 5-[[4-(2,6-dibutyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 2,6-Dibutyl-4-phenyl-1-{4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl}-1$l^{5}-pyridin-1-ylium perchlorate |
|---|---|
| PubChem CID | 11262485 |
| Molecular Formula | C27H32N5O4S3+ |
| Molecular Weight | 586.80 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 5-[[4-(2,6-dibutyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | CCCCC1=CC(=CC(=[N+]1C2=CC=C(C=C2)S(=O)(=O)NC3=NN=C(S3)S(=O)(=O)N)CCCC)C4=CC=CC=C4 |
| InChI | InChI=1S/C27H32N5O4S3/c1-3-5-12-23-18-21(20-10-8-7-9-11-20)19-24(13-6-4-2)32(23)22-14-16-25(17-15-22)39(35,36)31-26-29-30-27(37-26)38(28,33)34/h7-11,14-19H,3-6,12-13H2,1-2H3,(H,29,31)(H2,28,33,34)/q+1 |
| InChIKey | GPRWAZNAHSCQBJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 181.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | 939 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|