C32H37F9O4S — CID 11262497
10-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid (PubChem CID 11262497) has the molecular formula C32H37F9O4S and a molecular weight of 688.69 g/mol. Its IUPAC name is 10-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid.
| Compound Name | 10-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
|---|---|
| PubChem CID | 11262497 |
| Molecular Formula | C32H37F9O4S |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | 10-[(3S,4S)-7-hydroxy-3-(4-hydroxyphenyl)-3-methyl-2,4-dihydrothiochromen-4-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
| SMILES | C[C@]1(c2ccc(O)cc2)CSc2cc(O)ccc2[C@H]1CCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C32H37F9O4S/c1-28(21-10-12-22(42)13-11-21)19-46-26-18-23(43)14-15-24(26)25(28)9-7-5-3-2-4-6-8-20(27(44)45)16-17-29(33,34)30(35,36)31(37,38)32(39,40)41/h10-15,18,20,25,42-43H,2-9,16-17,19H2,1H3,(H,44,45)/t20?,25-,28-/m1/s1 |
| InChIKey | JRMANMBRBIFIFQ-JLJWFRADSA-N |
| XLogP | 10.31 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|