C12H16FN3O — CID 112625734
3-fluoro-4-[3-(hydroxymethyl)pyrrolidin-1-yl]benzenecarboximidamide (PubChem CID 112625734) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-fluoro-4-[3-(hydroxymethyl)pyrrolidin-1-yl]benzenecarboximidamide.
| Compound Name | 3-fluoro-4-[3-(hydroxymethyl)pyrrolidin-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 112625734 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-fluoro-4-[3-(hydroxymethyl)pyrrolidin-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(CO)C2)c(F)c1 |
| InChI | InChI=1S/C12H16FN3O/c13-10-5-9(12(14)15)1-2-11(10)16-4-3-8(6-16)7-17/h1-2,5,8,17H,3-4,6-7H2,(H3,14,15) |
| InChIKey | RIGPEYURVTXQRD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|