C12H16ClNO2S — CID 112626431
1-(5-chlorothiophen-2-yl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 112626431) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 1-(5-chlorothiophen-2-yl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 112626431 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(C(=O)c1ccc(Cl)s1)N1CCC(CO)C1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-8(14-5-4-9(6-14)7-15)12(16)10-2-3-11(13)17-10/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | RTESBFJWEPRPBG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |